C18H29ClN2O3 — CID 120914206
1-(2-methoxyphenyl)-2-[(2-morpholin-3-ylcyclopentyl)amino]ethanol;hydrochloride (PubChem CID 120914206) has the molecular formula C18H29ClN2O3 and a molecular weight of 356.89 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-2-[(2-morpholin-3-ylcyclopentyl)amino]ethanol;hydrochloride.
| Compound Name | 1-(2-methoxyphenyl)-2-[(2-morpholin-3-ylcyclopentyl)amino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 120914206 |
| Molecular Formula | C18H29ClN2O3 |
| Molecular Weight | 356.89 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 1-(2-methoxyphenyl)-2-[(2-morpholin-3-ylcyclopentyl)amino]ethanol;hydrochloride |
| SMILES | COc1ccccc1C(O)CNC1CCCC1C1COCCN1.Cl |
| InChI | InChI=1S/C18H28N2O3.ClH/c1-22-18-8-3-2-5-14(18)17(21)11-20-15-7-4-6-13(15)16-12-23-10-9-19-16;/h2-3,5,8,13,15-17,19-21H,4,6-7,9-12H2,1H3;1H |
| InChIKey | LCJRTFCEWSZYMX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.89 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |