C18H29ClN2O2 — CID 120914428
N-[2-(2-methoxyphenyl)ethyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride (PubChem CID 120914428) has the molecular formula C18H29ClN2O2 and a molecular weight of 340.89 g/mol. Its IUPAC name is N-[2-(2-methoxyphenyl)ethyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride.
| Compound Name | N-[2-(2-methoxyphenyl)ethyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120914428 |
| Molecular Formula | C18H29ClN2O2 |
| Molecular Weight | 340.89 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-[2-(2-methoxyphenyl)ethyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride |
| SMILES | COc1ccccc1CCNC1CCCC1C1COCCN1.Cl |
| InChI | InChI=1S/C18H28N2O2.ClH/c1-21-18-8-3-2-5-14(18)9-10-19-16-7-4-6-15(16)17-13-22-12-11-20-17;/h2-3,5,8,15-17,19-20H,4,6-7,9-13H2,1H3;1H |
| InChIKey | GDMUAQWHIPOWKE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.89 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |