C15H24Cl2N2OS — CID 120914266
N-[2-(5-chlorothiophen-2-yl)ethyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride (PubChem CID 120914266) has the molecular formula C15H24Cl2N2OS and a molecular weight of 351.34 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120914266 |
| Molecular Formula | C15H24Cl2N2OS |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride |
| SMILES | Cl.Clc1ccc(CCNC2CCCC2C2COCCN2)s1 |
| InChI | InChI=1S/C15H23ClN2OS.ClH/c16-15-5-4-11(20-15)6-7-17-13-3-1-2-12(13)14-10-19-9-8-18-14;/h4-5,12-14,17-18H,1-3,6-10H2;1H |
| InChIKey | FQHUKOPQSAVESD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |