C15H30N2O — CID 120913877
N-(3,3-dimethylbutyl)-2-morpholin-3-ylcyclopentan-1-amine (PubChem CID 120913877) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-2-morpholin-3-ylcyclopentan-1-amine.
| Compound Name | N-(3,3-dimethylbutyl)-2-morpholin-3-ylcyclopentan-1-amine |
|---|---|
| PubChem CID | 120913877 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | N-(3,3-dimethylbutyl)-2-morpholin-3-ylcyclopentan-1-amine |
| SMILES | CC(C)(C)CCNC1CCCC1C1COCCN1 |
| InChI | InChI=1S/C15H30N2O/c1-15(2,3)7-8-16-13-6-4-5-12(13)14-11-18-10-9-17-14/h12-14,16-17H,4-11H2,1-3H3 |
| InChIKey | QPXZSIZSCQVZNL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |