C15H31ClN2O3S — CID 120916306
N-(2-tert-butylsulfonylethyl)-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride (PubChem CID 120916306) has the molecular formula C15H31ClN2O3S and a molecular weight of 354.94 g/mol. Its IUPAC name is N-(2-tert-butylsulfonylethyl)-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride.
| Compound Name | N-(2-tert-butylsulfonylethyl)-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120916306 |
| Molecular Formula | C15H31ClN2O3S |
| Molecular Weight | 354.94 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-(2-tert-butylsulfonylethyl)-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride |
| SMILES | CC(C)(C)S(=O)(=O)CCNC1CCCC1C1COCCN1.Cl |
| InChI | InChI=1S/C15H30N2O3S.ClH/c1-15(2,3)21(18,19)10-8-17-13-6-4-5-12(13)14-11-20-9-7-16-14;/h12-14,16-17H,4-11H2,1-3H3;1H |
| InChIKey | ZSYXKWJPIWHZQN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.94 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |