C15H29N3O3S — CID 120916417
N-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]-2-morpholin-3-ylcyclopentan-1-amine (PubChem CID 120916417) has the molecular formula C15H29N3O3S and a molecular weight of 331.48 g/mol. Its IUPAC name is N-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]-2-morpholin-3-ylcyclopentan-1-amine.
| Compound Name | N-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]-2-morpholin-3-ylcyclopentan-1-amine |
|---|---|
| PubChem CID | 120916417 |
| Molecular Formula | C15H29N3O3S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]-2-morpholin-3-ylcyclopentan-1-amine |
| SMILES | CS(=O)(=O)N1CCC[C@@H]1CNC1CCCC1C1COCCN1 |
| InChI | InChI=1S/C15H29N3O3S/c1-22(19,20)18-8-3-4-12(18)10-17-14-6-2-5-13(14)15-11-21-9-7-16-15/h12-17H,2-11H2,1H3/t12-,13?,14?,15?/m1/s1 |
| InChIKey | CJOPMMGIYDDEBV-AUXXQLBISA-N |
| XLogP | 0.16 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |