C19H37ClN2O2 — CID 120914546
N-[(2-tert-butyloxan-3-yl)methyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride (PubChem CID 120914546) has the molecular formula C19H37ClN2O2 and a molecular weight of 360.97 g/mol. Its IUPAC name is N-[(2-tert-butyloxan-3-yl)methyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride.
| Compound Name | N-[(2-tert-butyloxan-3-yl)methyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120914546 |
| Molecular Formula | C19H37ClN2O2 |
| Molecular Weight | 360.97 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | N-[(2-tert-butyloxan-3-yl)methyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride |
| SMILES | CC(C)(C)C1OCCCC1CNC1CCCC1C1COCCN1.Cl |
| InChI | InChI=1S/C19H36N2O2.ClH/c1-19(2,3)18-14(6-5-10-23-18)12-21-16-8-4-7-15(16)17-13-22-11-9-20-17;/h14-18,20-21H,4-13H2,1-3H3;1H |
| InChIKey | DXWMFBCGKVRZPU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.97 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |