C21H35ClN2O2 — CID 120916338
N-[2-(3-tert-butylphenoxy)ethyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride (PubChem CID 120916338) has the molecular formula C21H35ClN2O2 and a molecular weight of 382.98 g/mol. Its IUPAC name is N-[2-(3-tert-butylphenoxy)ethyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride.
| Compound Name | N-[2-(3-tert-butylphenoxy)ethyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120916338 |
| Molecular Formula | C21H35ClN2O2 |
| Molecular Weight | 382.98 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-[2-(3-tert-butylphenoxy)ethyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride |
| SMILES | CC(C)(C)c1cccc(OCCNC2CCCC2C2COCCN2)c1.Cl |
| InChI | InChI=1S/C21H34N2O2.ClH/c1-21(2,3)16-6-4-7-17(14-16)25-13-11-22-19-9-5-8-18(19)20-15-24-12-10-23-20;/h4,6-7,14,18-20,22-23H,5,8-13,15H2,1-3H3;1H |
| InChIKey | JAFMKCOSFXLNMS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.98 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|