C20H29F3N2O — CID 120915869
N-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]-2-morpholin-3-ylcyclopentan-1-amine (PubChem CID 120915869) has the molecular formula C20H29F3N2O and a molecular weight of 370.46 g/mol. Its IUPAC name is N-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]-2-morpholin-3-ylcyclopentan-1-amine.
| Compound Name | N-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]-2-morpholin-3-ylcyclopentan-1-amine |
|---|---|
| PubChem CID | 120915869 |
| Molecular Formula | C20H29F3N2O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | N-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]-2-morpholin-3-ylcyclopentan-1-amine |
| SMILES | CC(C)(CNC1CCCC1C1COCCN1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H29F3N2O/c1-19(2,14-5-3-6-15(11-14)20(21,22)23)13-25-17-8-4-7-16(17)18-12-26-10-9-24-18/h3,5-6,11,16-18,24-25H,4,7-10,12-13H2,1-2H3 |
| InChIKey | PJIOBTLFIZQELQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |