C19H29BrN2O — CID 120915631
N-[2-(3-bromophenyl)-2-methylpropyl]-2-morpholin-3-ylcyclopentan-1-amine (PubChem CID 120915631) has the molecular formula C19H29BrN2O and a molecular weight of 381.36 g/mol. Its IUPAC name is N-[2-(3-bromophenyl)-2-methylpropyl]-2-morpholin-3-ylcyclopentan-1-amine.
| Compound Name | N-[2-(3-bromophenyl)-2-methylpropyl]-2-morpholin-3-ylcyclopentan-1-amine |
|---|---|
| PubChem CID | 120915631 |
| Molecular Formula | C19H29BrN2O |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[2-(3-bromophenyl)-2-methylpropyl]-2-morpholin-3-ylcyclopentan-1-amine |
| SMILES | CC(C)(CNC1CCCC1C1COCCN1)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H29BrN2O/c1-19(2,14-5-3-6-15(20)11-14)13-22-17-8-4-7-16(17)18-12-23-10-9-21-18/h3,5-6,11,16-18,21-22H,4,7-10,12-13H2,1-2H3 |
| InChIKey | DSKFZPCEJGDRFK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |