C15H26ClN5O — CID 120915684
N-(2-morpholin-3-ylcyclopentyl)-N'-pyrazin-2-ylethane-1,2-diamine;hydrochloride (PubChem CID 120915684) has the molecular formula C15H26ClN5O and a molecular weight of 327.86 g/mol. Its IUPAC name is N-(2-morpholin-3-ylcyclopentyl)-N'-pyrazin-2-ylethane-1,2-diamine;hydrochloride.
| Compound Name | N-(2-morpholin-3-ylcyclopentyl)-N'-pyrazin-2-ylethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 120915684 |
| Molecular Formula | C15H26ClN5O |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-(2-morpholin-3-ylcyclopentyl)-N'-pyrazin-2-ylethane-1,2-diamine;hydrochloride |
| SMILES | Cl.c1cnc(NCCNC2CCCC2C2COCCN2)cn1 |
| InChI | InChI=1S/C15H25N5O.ClH/c1-2-12(14-11-21-9-8-18-14)13(3-1)17-6-7-20-15-10-16-4-5-19-15;/h4-5,10,12-14,17-18H,1-3,6-9,11H2,(H,19,20);1H |
| InChIKey | FOBHDUWXSWLYNT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 71.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|