C21H32ClN3O — CID 120915910
N-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride (PubChem CID 120915910) has the molecular formula C21H32ClN3O and a molecular weight of 377.96 g/mol. Its IUPAC name is N-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride.
| Compound Name | N-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120915910 |
| Molecular Formula | C21H32ClN3O |
| Molecular Weight | 377.96 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | N-[2-(7-ethyl-1H-indol-3-yl)ethyl]-2-morpholin-3-ylcyclopentan-1-amine;hydrochloride |
| SMILES | CCc1cccc2c(CCNC3CCCC3C3COCCN3)c[nH]c12.Cl |
| InChI | InChI=1S/C21H31N3O.ClH/c1-2-15-5-3-6-17-16(13-24-21(15)17)9-10-22-19-8-4-7-18(19)20-14-25-12-11-23-20;/h3,5-6,13,18-20,22-24H,2,4,7-12,14H2,1H3;1H |
| InChIKey | KGZINMGFPSKVON-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.96 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |