C21H31N3O2 — CID 120914967
N-[3-[[(2-morpholin-3-ylcyclopentyl)amino]methyl]phenyl]cyclobutanecarboxamide (PubChem CID 120914967) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[3-[[(2-morpholin-3-ylcyclopentyl)amino]methyl]phenyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[(2-morpholin-3-ylcyclopentyl)amino]methyl]phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 120914967 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | N-[3-[[(2-morpholin-3-ylcyclopentyl)amino]methyl]phenyl]cyclobutanecarboxamide |
| SMILES | O=C(Nc1cccc(CNC2CCCC2C2COCCN2)c1)C1CCC1 |
| InChI | InChI=1S/C21H31N3O2/c25-21(16-5-2-6-16)24-17-7-1-4-15(12-17)13-23-19-9-3-8-18(19)20-14-26-11-10-22-20/h1,4,7,12,16,18-20,22-23H,2-3,5-6,8-11,13-14H2,(H,24,25) |
| InChIKey | ULZUENPLBPEKSI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |