C21H31N3O3 — CID 120915797
N-[3-[[(2-morpholin-3-ylcyclopentyl)amino]methyl]phenyl]oxolane-2-carboxamide (PubChem CID 120915797) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[3-[[(2-morpholin-3-ylcyclopentyl)amino]methyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[(2-morpholin-3-ylcyclopentyl)amino]methyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120915797 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | N-[3-[[(2-morpholin-3-ylcyclopentyl)amino]methyl]phenyl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1cccc(CNC2CCCC2C2COCCN2)c1)C1CCCO1 |
| InChI | InChI=1S/C21H31N3O3/c25-21(20-8-3-10-27-20)24-16-5-1-4-15(12-16)13-23-18-7-2-6-17(18)19-14-26-11-9-22-19/h1,4-5,12,17-20,22-23H,2-3,6-11,13-14H2,(H,24,25) |
| InChIKey | WCHBPIDEHZITOK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |