C19H31ClN4O — CID 120915468
N-(2-morpholin-3-ylcyclopentyl)-1-pyridin-2-ylpiperidin-4-amine;hydrochloride (PubChem CID 120915468) has the molecular formula C19H31ClN4O and a molecular weight of 366.94 g/mol. Its IUPAC name is N-(2-morpholin-3-ylcyclopentyl)-1-pyridin-2-ylpiperidin-4-amine;hydrochloride.
| Compound Name | N-(2-morpholin-3-ylcyclopentyl)-1-pyridin-2-ylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120915468 |
| Molecular Formula | C19H31ClN4O |
| Molecular Weight | 366.94 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | N-(2-morpholin-3-ylcyclopentyl)-1-pyridin-2-ylpiperidin-4-amine;hydrochloride |
| SMILES | Cl.c1ccc(N2CCC(NC3CCCC3C3COCCN3)CC2)nc1 |
| InChI | InChI=1S/C19H30N4O.ClH/c1-2-9-21-19(6-1)23-11-7-15(8-12-23)22-17-5-3-4-16(17)18-14-24-13-10-20-18;/h1-2,6,9,15-18,20,22H,3-5,7-8,10-14H2;1H |
| InChIKey | AWRBNRLINKIFAR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.94 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |