C24H39N3O — CID 120914461
1-(4-tert-butylphenyl)-N-(2-morpholin-3-ylcyclopentyl)piperidin-4-amine (PubChem CID 120914461) has the molecular formula C24H39N3O and a molecular weight of 385.60 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-N-(2-morpholin-3-ylcyclopentyl)piperidin-4-amine.
| Compound Name | 1-(4-tert-butylphenyl)-N-(2-morpholin-3-ylcyclopentyl)piperidin-4-amine |
|---|---|
| PubChem CID | 120914461 |
| Molecular Formula | C24H39N3O |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.31 |
| IUPAC Name | 1-(4-tert-butylphenyl)-N-(2-morpholin-3-ylcyclopentyl)piperidin-4-amine |
| SMILES | CC(C)(C)c1ccc(N2CCC(NC3CCCC3C3COCCN3)CC2)cc1 |
| InChI | InChI=1S/C24H39N3O/c1-24(2,3)18-7-9-20(10-8-18)27-14-11-19(12-15-27)26-22-6-4-5-21(22)23-17-28-16-13-25-23/h7-10,19,21-23,25-26H,4-6,11-17H2,1-3H3 |
| InChIKey | JLTXUVGBQVOFCY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |