C17H32N4O2 — CID 120915273
N-methyl-2-[4-[(2-morpholin-3-ylcyclopentyl)amino]piperidin-1-yl]acetamide (PubChem CID 120915273) has the molecular formula C17H32N4O2 and a molecular weight of 324.47 g/mol. Its IUPAC name is N-methyl-2-[4-[(2-morpholin-3-ylcyclopentyl)amino]piperidin-1-yl]acetamide.
| Compound Name | N-methyl-2-[4-[(2-morpholin-3-ylcyclopentyl)amino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 120915273 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | N-methyl-2-[4-[(2-morpholin-3-ylcyclopentyl)amino]piperidin-1-yl]acetamide |
| SMILES | CNC(=O)CN1CCC(NC2CCCC2C2COCCN2)CC1 |
| InChI | InChI=1S/C17H32N4O2/c1-18-17(22)11-21-8-5-13(6-9-21)20-15-4-2-3-14(15)16-12-23-10-7-19-16/h13-16,19-20H,2-12H2,1H3,(H,18,22) |
| InChIKey | MSPSUYJIORCAFC-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |