C17H32N2O — CID 120916095
N-[[1-(2-methylpropyl)cyclopropyl]methyl]-2-morpholin-3-ylcyclopentan-1-amine (PubChem CID 120916095) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is N-[[1-(2-methylpropyl)cyclopropyl]methyl]-2-morpholin-3-ylcyclopentan-1-amine.
| Compound Name | N-[[1-(2-methylpropyl)cyclopropyl]methyl]-2-morpholin-3-ylcyclopentan-1-amine |
|---|---|
| PubChem CID | 120916095 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | N-[[1-(2-methylpropyl)cyclopropyl]methyl]-2-morpholin-3-ylcyclopentan-1-amine |
| SMILES | CC(C)CC1(CNC2CCCC2C2COCCN2)CC1 |
| InChI | InChI=1S/C17H32N2O/c1-13(2)10-17(6-7-17)12-19-15-5-3-4-14(15)16-11-20-9-8-18-16/h13-16,18-19H,3-12H2,1-2H3 |
| InChIKey | YYMJDYGJRJZIMK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |