C14H19FN4O — CID 120916619
(4aR,7aS)-1-(6-ethyl-5-fluoropyrimidin-4-yl)-6-methyl-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one (PubChem CID 120916619) has the molecular formula C14H19FN4O and a molecular weight of 278.33 g/mol. Its IUPAC name is (4aR,7aS)-1-(6-ethyl-5-fluoropyrimidin-4-yl)-6-methyl-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (4aR,7aS)-1-(6-ethyl-5-fluoropyrimidin-4-yl)-6-methyl-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 120916619 |
| Molecular Formula | C14H19FN4O |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (4aR,7aS)-1-(6-ethyl-5-fluoropyrimidin-4-yl)-6-methyl-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one |
| SMILES | CCc1ncnc(N2CCC[C@H]3C(=O)N(C)C[C@H]32)c1F |
| InChI | InChI=1S/C14H19FN4O/c1-3-10-12(15)13(17-8-16-10)19-6-4-5-9-11(19)7-18(2)14(9)20/h8-9,11H,3-7H2,1-2H3/t9-,11-/m1/s1 |
| InChIKey | MRMXETFOQIWLGH-MWLCHTKSSA-N |
| XLogP | 1.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |