C18H28FN5O — CID 75514646
cyclopentyl-[4-[2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]ethyl]piperazin-1-yl]methanone (PubChem CID 75514646) has the molecular formula C18H28FN5O and a molecular weight of 349.45 g/mol. Its IUPAC name is cyclopentyl-[4-[2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]ethyl]piperazin-1-yl]methanone.
| Compound Name | cyclopentyl-[4-[2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 75514646 |
| Molecular Formula | C18H28FN5O |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | cyclopentyl-[4-[2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]ethyl]piperazin-1-yl]methanone |
| SMILES | CCc1ncnc(NCCN2CCN(C(=O)C3CCCC3)CC2)c1F |
| InChI | InChI=1S/C18H28FN5O/c1-2-15-16(19)17(22-13-21-15)20-7-8-23-9-11-24(12-10-23)18(25)14-5-3-4-6-14/h13-14H,2-12H2,1H3,(H,20,21,22) |
| InChIKey | MSUMHNALNMTAKF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |