C13H17ClN2O3 — CID 120917710
(2R,3S)-N-(3-chloro-4-methoxyphenyl)-2-methylmorpholine-3-carboxamide (PubChem CID 120917710) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is (2R,3S)-N-(3-chloro-4-methoxyphenyl)-2-methylmorpholine-3-carboxamide.
| Compound Name | (2R,3S)-N-(3-chloro-4-methoxyphenyl)-2-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 120917710 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (2R,3S)-N-(3-chloro-4-methoxyphenyl)-2-methylmorpholine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@H]2NCCO[C@@H]2C)cc1Cl |
| InChI | InChI=1S/C13H17ClN2O3/c1-8-12(15-5-6-19-8)13(17)16-9-3-4-11(18-2)10(14)7-9/h3-4,7-8,12,15H,5-6H2,1-2H3,(H,16,17)/t8-,12+/m1/s1 |
| InChIKey | IVBWCUPFFJFYLE-PELKAZGASA-N |
| XLogP | 1.66 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |