C17H21FN4O — CID 120918675
N-[(4-fluorophenyl)methyl]-N-methyl-4-pyrazol-1-ylpiperidine-4-carboxamide (PubChem CID 120918675) has the molecular formula C17H21FN4O and a molecular weight of 316.38 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-methyl-4-pyrazol-1-ylpiperidine-4-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-methyl-4-pyrazol-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120918675 |
| Molecular Formula | C17H21FN4O |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-methyl-4-pyrazol-1-ylpiperidine-4-carboxamide |
| SMILES | CN(Cc1ccc(F)cc1)C(=O)C1(n2cccn2)CCNCC1 |
| InChI | InChI=1S/C17H21FN4O/c1-21(13-14-3-5-15(18)6-4-14)16(23)17(7-10-19-11-8-17)22-12-2-9-20-22/h2-6,9,12,19H,7-8,10-11,13H2,1H3 |
| InChIKey | ZJTUTFKEUVQKKX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |