C21H27FN4O — CID 120930215
[4-[(4-fluorophenyl)methyl]piperidin-1-yl]-(4-pyrazol-1-ylpiperidin-4-yl)methanone (PubChem CID 120930215) has the molecular formula C21H27FN4O and a molecular weight of 370.47 g/mol. Its IUPAC name is [4-[(4-fluorophenyl)methyl]piperidin-1-yl]-(4-pyrazol-1-ylpiperidin-4-yl)methanone.
| Compound Name | [4-[(4-fluorophenyl)methyl]piperidin-1-yl]-(4-pyrazol-1-ylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 120930215 |
| Molecular Formula | C21H27FN4O |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | [4-[(4-fluorophenyl)methyl]piperidin-1-yl]-(4-pyrazol-1-ylpiperidin-4-yl)methanone |
| SMILES | O=C(N1CCC(Cc2ccc(F)cc2)CC1)C1(n2cccn2)CCNCC1 |
| InChI | InChI=1S/C21H27FN4O/c22-19-4-2-17(3-5-19)16-18-6-14-25(15-7-18)20(27)21(8-11-23-12-9-21)26-13-1-10-24-26/h1-5,10,13,18,23H,6-9,11-12,14-16H2 |
| InChIKey | FTGKPBIELCVJRY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |