C14H16F3N3O3 — CID 120918765
(2R,3S)-2-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]morpholine-3-carboxamide (PubChem CID 120918765) has the molecular formula C14H16F3N3O3 and a molecular weight of 331.29 g/mol. Its IUPAC name is (2R,3S)-2-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]morpholine-3-carboxamide.
| Compound Name | (2R,3S)-2-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 120918765 |
| Molecular Formula | C14H16F3N3O3 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (2R,3S)-2-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]morpholine-3-carboxamide |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H16F3N3O3/c1-7-13(18-4-5-23-7)14(22)19-6-10(21)20-9-3-2-8(15)11(16)12(9)17/h2-3,7,13,18H,4-6H2,1H3,(H,19,22)(H,20,21)/t7-,13+/m1/s1 |
| InChIKey | TZSBZDHWGDPGNS-UHLUBPPHSA-N |
| XLogP | 0.54 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|