C18H29N3O4S — CID 120919058
(2R,3S)-N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-2-methylmorpholine-3-carboxamide (PubChem CID 120919058) has the molecular formula C18H29N3O4S and a molecular weight of 383.51 g/mol. Its IUPAC name is (2R,3S)-N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-2-methylmorpholine-3-carboxamide.
| Compound Name | (2R,3S)-N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-2-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 120919058 |
| Molecular Formula | C18H29N3O4S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (2R,3S)-N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-2-methylmorpholine-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(C)NC(=O)[C@H]2NCCO[C@@H]2C)cc1 |
| InChI | InChI=1S/C18H29N3O4S/c1-5-21(6-2)26(23,24)16-9-7-15(8-10-16)13(3)20-18(22)17-14(4)25-12-11-19-17/h7-10,13-14,17,19H,5-6,11-12H2,1-4H3,(H,20,22)/t13?,14-,17+/m1/s1 |
| InChIKey | ZZRLUYLZPHLOQU-ROFXEPAZSA-N |
| XLogP | 1.27 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |