C19H23N5O4 — CID 120919843
methyl 2-[[4-[(4-pyrazol-1-ylpiperidine-4-carbonyl)amino]benzoyl]amino]acetate (PubChem CID 120919843) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is methyl 2-[[4-[(4-pyrazol-1-ylpiperidine-4-carbonyl)amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-[(4-pyrazol-1-ylpiperidine-4-carbonyl)amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 120919843 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | methyl 2-[[4-[(4-pyrazol-1-ylpiperidine-4-carbonyl)amino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(NC(=O)C2(n3cccn3)CCNCC2)cc1 |
| InChI | InChI=1S/C19H23N5O4/c1-28-16(25)13-21-17(26)14-3-5-15(6-4-14)23-18(27)19(7-10-20-11-8-19)24-12-2-9-22-24/h2-6,9,12,20H,7-8,10-11,13H2,1H3,(H,21,26)(H,23,27) |
| InChIKey | BHHOEMCRMJFEDS-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |