C12H19ClN4O3 — CID 120924676
methyl 2-[(4-pyrazol-1-ylpiperidine-4-carbonyl)amino]acetate;hydrochloride (PubChem CID 120924676) has the molecular formula C12H19ClN4O3 and a molecular weight of 302.76 g/mol. Its IUPAC name is methyl 2-[(4-pyrazol-1-ylpiperidine-4-carbonyl)amino]acetate;hydrochloride.
| Compound Name | methyl 2-[(4-pyrazol-1-ylpiperidine-4-carbonyl)amino]acetate;hydrochloride |
|---|---|
| PubChem CID | 120924676 |
| Molecular Formula | C12H19ClN4O3 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | methyl 2-[(4-pyrazol-1-ylpiperidine-4-carbonyl)amino]acetate;hydrochloride |
| SMILES | COC(=O)CNC(=O)C1(n2cccn2)CCNCC1.Cl |
| InChI | InChI=1S/C12H18N4O3.ClH/c1-19-10(17)9-14-11(18)12(3-6-13-7-4-12)16-8-2-5-15-16;/h2,5,8,13H,3-4,6-7,9H2,1H3,(H,14,18);1H |
| InChIKey | RKTKFCBMPHCCET-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |