C15H25N5O2 — CID 120921332
N-[3-oxo-3-(propan-2-ylamino)propyl]-4-pyrazol-1-ylpiperidine-4-carboxamide (PubChem CID 120921332) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is N-[3-oxo-3-(propan-2-ylamino)propyl]-4-pyrazol-1-ylpiperidine-4-carboxamide.
| Compound Name | N-[3-oxo-3-(propan-2-ylamino)propyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120921332 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | N-[3-oxo-3-(propan-2-ylamino)propyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
| SMILES | CC(C)NC(=O)CCNC(=O)C1(n2cccn2)CCNCC1 |
| InChI | InChI=1S/C15H25N5O2/c1-12(2)19-13(21)4-8-17-14(22)15(5-9-16-10-6-15)20-11-3-7-18-20/h3,7,11-12,16H,4-6,8-10H2,1-2H3,(H,17,22)(H,19,21) |
| InChIKey | ARKYXPOAJUYWSG-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |