C14H27Cl2N5O — CID 120940230
N-[2-[ethyl(methyl)amino]ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;dihydrochloride (PubChem CID 120940230) has the molecular formula C14H27Cl2N5O and a molecular weight of 352.31 g/mol. Its IUPAC name is N-[2-[ethyl(methyl)amino]ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;dihydrochloride.
| Compound Name | N-[2-[ethyl(methyl)amino]ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120940230 |
| Molecular Formula | C14H27Cl2N5O |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[2-[ethyl(methyl)amino]ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;dihydrochloride |
| SMILES | CCN(C)CCNC(=O)C1(n2cccn2)CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H25N5O.2ClH/c1-3-18(2)12-10-16-13(20)14(5-8-15-9-6-14)19-11-4-7-17-19;;/h4,7,11,15H,3,5-6,8-10,12H2,1-2H3,(H,16,20);2*1H |
| InChIKey | DLADNPFEKRODPL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |