C18H32N6O — CID 120942485
N-[2-[4-(dimethylamino)piperidin-1-yl]ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide (PubChem CID 120942485) has the molecular formula C18H32N6O and a molecular weight of 348.50 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)piperidin-1-yl]ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide.
| Compound Name | N-[2-[4-(dimethylamino)piperidin-1-yl]ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120942485 |
| Molecular Formula | C18H32N6O |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | N-[2-[4-(dimethylamino)piperidin-1-yl]ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
| SMILES | CN(C)C1CCN(CCNC(=O)C2(n3cccn3)CCNCC2)CC1 |
| InChI | InChI=1S/C18H32N6O/c1-22(2)16-4-13-23(14-5-16)15-11-20-17(25)18(6-9-19-10-7-18)24-12-3-8-21-24/h3,8,12,16,19H,4-7,9-11,13-15H2,1-2H3,(H,20,25) |
| InChIKey | ISMCOLVOQIECKM-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |