C19H27ClN4O4 — CID 120924278
(3R,4S)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 120924278) has the molecular formula C19H27ClN4O4 and a molecular weight of 410.90 g/mol. Its IUPAC name is (3R,4S)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | (3R,4S)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120924278 |
| Molecular Formula | C19H27ClN4O4 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (3R,4S)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | COCCOc1cc(NC(=O)[C@H]2CNC[C@@H]2c2cnn(C)c2)ccc1OC.Cl |
| InChI | InChI=1S/C19H26N4O4.ClH/c1-23-12-13(9-21-23)15-10-20-11-16(15)19(24)22-14-4-5-17(26-3)18(8-14)27-7-6-25-2;/h4-5,8-9,12,15-16,20H,6-7,10-11H2,1-3H3,(H,22,24);1H/t15-,16+;/m1./s1 |
| InChIKey | QJSOJCWYFRIGQC-RCPFAERMSA-N |
| XLogP | 1.82 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|