C18H24ClFN4O3 — CID 120928611
(3R,4S)-N-[5-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 120928611) has the molecular formula C18H24ClFN4O3 and a molecular weight of 398.87 g/mol. Its IUPAC name is (3R,4S)-N-[5-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | (3R,4S)-N-[5-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120928611 |
| Molecular Formula | C18H24ClFN4O3 |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (3R,4S)-N-[5-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | COCCOc1ccc(F)cc1NC(=O)[C@H]1CNC[C@@H]1c1cnn(C)c1.Cl |
| InChI | InChI=1S/C18H23FN4O3.ClH/c1-23-11-12(8-21-23)14-9-20-10-15(14)18(24)22-16-7-13(19)3-4-17(16)26-6-5-25-2;/h3-4,7-8,11,14-15,20H,5-6,9-10H2,1-2H3,(H,22,24);1H/t14-,15+;/m1./s1 |
| InChIKey | SBJPGOCRDSTXSE-LIOBNPLQSA-N |
| XLogP | 1.95 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|