C13H23N3O3 — CID 120924842
2-[1-[(2R,3S)-2-methylmorpholine-3-carbonyl]piperidin-4-yl]acetamide (PubChem CID 120924842) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-[1-[(2R,3S)-2-methylmorpholine-3-carbonyl]piperidin-4-yl]acetamide.
| Compound Name | 2-[1-[(2R,3S)-2-methylmorpholine-3-carbonyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 120924842 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 2-[1-[(2R,3S)-2-methylmorpholine-3-carbonyl]piperidin-4-yl]acetamide |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)N1CCC(CC(N)=O)CC1 |
| InChI | InChI=1S/C13H23N3O3/c1-9-12(15-4-7-19-9)13(18)16-5-2-10(3-6-16)8-11(14)17/h9-10,12,15H,2-8H2,1H3,(H2,14,17)/t9-,12+/m1/s1 |
| InChIKey | UYVLWBHXGPHPNB-SKDRFNHKSA-N |
| XLogP | -0.52 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |