C14H26N2O4 — CID 120935890
[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-[(2R,3S)-2-methylmorpholin-3-yl]methanone (PubChem CID 120935890) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is [3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-[(2R,3S)-2-methylmorpholin-3-yl]methanone.
| Compound Name | [3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-[(2R,3S)-2-methylmorpholin-3-yl]methanone |
|---|---|
| PubChem CID | 120935890 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | [3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-[(2R,3S)-2-methylmorpholin-3-yl]methanone |
| SMILES | COCCOCC1CCN(C(=O)[C@H]2NCCO[C@@H]2C)C1 |
| InChI | InChI=1S/C14H26N2O4/c1-11-13(15-4-6-20-11)14(17)16-5-3-12(9-16)10-19-8-7-18-2/h11-13,15H,3-10H2,1-2H3/t11-,12?,13+/m1/s1 |
| InChIKey | PZKCLNRGBMDVSW-YPHAAILGSA-N |
| XLogP | -0.13 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|