C18H25FN2O3 — CID 120928895
[4-(aminomethyl)oxan-4-yl]-[4-(4-fluorophenoxy)piperidin-1-yl]methanone (PubChem CID 120928895) has the molecular formula C18H25FN2O3 and a molecular weight of 336.41 g/mol. Its IUPAC name is [4-(aminomethyl)oxan-4-yl]-[4-(4-fluorophenoxy)piperidin-1-yl]methanone.
| Compound Name | [4-(aminomethyl)oxan-4-yl]-[4-(4-fluorophenoxy)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 120928895 |
| Molecular Formula | C18H25FN2O3 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [4-(aminomethyl)oxan-4-yl]-[4-(4-fluorophenoxy)piperidin-1-yl]methanone |
| SMILES | NCC1(C(=O)N2CCC(Oc3ccc(F)cc3)CC2)CCOCC1 |
| InChI | InChI=1S/C18H25FN2O3/c19-14-1-3-15(4-2-14)24-16-5-9-21(10-6-16)17(22)18(13-20)7-11-23-12-8-18/h1-4,16H,5-13,20H2 |
| InChIKey | VWOXCZKISYBWNL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |