C17H23FN2O3 — CID 96581347
1-[4-(4-fluorophenoxy)piperidin-1-yl]-2-[(3S)-morpholin-3-yl]ethanone (PubChem CID 96581347) has the molecular formula C17H23FN2O3 and a molecular weight of 322.38 g/mol. Its IUPAC name is 1-[4-(4-fluorophenoxy)piperidin-1-yl]-2-[(3S)-morpholin-3-yl]ethanone.
| Compound Name | 1-[4-(4-fluorophenoxy)piperidin-1-yl]-2-[(3S)-morpholin-3-yl]ethanone |
|---|---|
| PubChem CID | 96581347 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-[4-(4-fluorophenoxy)piperidin-1-yl]-2-[(3S)-morpholin-3-yl]ethanone |
| SMILES | O=C(C[C@H]1COCCN1)N1CCC(Oc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H23FN2O3/c18-13-1-3-15(4-2-13)23-16-5-8-20(9-6-16)17(21)11-14-12-22-10-7-19-14/h1-4,14,16,19H,5-12H2/t14-/m0/s1 |
| InChIKey | ZKOMZGNZHUTWNF-AWEZNQCLSA-N |
| XLogP | 1.57 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |