C21H30FN3O3 — CID 97278133
N-[(4-fluorophenyl)methyl]-3-[1-[2-[(3S)-morpholin-3-yl]acetyl]piperidin-4-yl]propanamide (PubChem CID 97278133) has the molecular formula C21H30FN3O3 and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-[1-[2-[(3S)-morpholin-3-yl]acetyl]piperidin-4-yl]propanamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-[1-[2-[(3S)-morpholin-3-yl]acetyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 97278133 |
| Molecular Formula | C21H30FN3O3 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-[1-[2-[(3S)-morpholin-3-yl]acetyl]piperidin-4-yl]propanamide |
| SMILES | O=C(CCC1CCN(C(=O)C[C@H]2COCCN2)CC1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H30FN3O3/c22-18-4-1-17(2-5-18)14-24-20(26)6-3-16-7-10-25(11-8-16)21(27)13-19-15-28-12-9-23-19/h1-2,4-5,16,19,23H,3,6-15H2,(H,24,26)/t19-/m0/s1 |
| InChIKey | JSSIZEAWDHJQNO-IBGZPJMESA-N |
| XLogP | 1.84 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |