C24H30FN3O2 — CID 42378837
4-[3-[(4-fluorophenyl)methylamino]-3-oxopropyl]-N-(2-phenylethyl)piperidine-1-carboxamide (PubChem CID 42378837) has the molecular formula C24H30FN3O2 and a molecular weight of 411.52 g/mol. Its IUPAC name is 4-[3-[(4-fluorophenyl)methylamino]-3-oxopropyl]-N-(2-phenylethyl)piperidine-1-carboxamide.
| Compound Name | 4-[3-[(4-fluorophenyl)methylamino]-3-oxopropyl]-N-(2-phenylethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 42378837 |
| Molecular Formula | C24H30FN3O2 |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 4-[3-[(4-fluorophenyl)methylamino]-3-oxopropyl]-N-(2-phenylethyl)piperidine-1-carboxamide |
| SMILES | O=C(CCC1CCN(C(=O)NCCc2ccccc2)CC1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H30FN3O2/c25-22-9-6-21(7-10-22)18-27-23(29)11-8-20-13-16-28(17-14-20)24(30)26-15-12-19-4-2-1-3-5-19/h1-7,9-10,20H,8,11-18H2,(H,26,30)(H,27,29) |
| InChIKey | IEDJXMFUSKETFS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |