C17H24FN3O2 — CID 70766726
1-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]-2-morpholin-3-ylethanone (PubChem CID 70766726) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]-2-morpholin-3-ylethanone.
| Compound Name | 1-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]-2-morpholin-3-ylethanone |
|---|---|
| PubChem CID | 70766726 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 1-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]-2-morpholin-3-ylethanone |
| SMILES | O=C(CC1COCCN1)N1CCCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H24FN3O2/c18-14-2-4-16(5-3-14)20-7-1-8-21(10-9-20)17(22)12-15-13-23-11-6-19-15/h2-5,15,19H,1,6-13H2 |
| InChIKey | NGGTYFOPJYBCMA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |