C18H28N4O4 — CID 120931889
methyl 2-(oxan-4-yl)-3-[(4-pyrazol-1-ylpiperidine-4-carbonyl)amino]propanoate (PubChem CID 120931889) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is methyl 2-(oxan-4-yl)-3-[(4-pyrazol-1-ylpiperidine-4-carbonyl)amino]propanoate.
| Compound Name | methyl 2-(oxan-4-yl)-3-[(4-pyrazol-1-ylpiperidine-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 120931889 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | methyl 2-(oxan-4-yl)-3-[(4-pyrazol-1-ylpiperidine-4-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(CNC(=O)C1(n2cccn2)CCNCC1)C1CCOCC1 |
| InChI | InChI=1S/C18H28N4O4/c1-25-16(23)15(14-3-11-26-12-4-14)13-20-17(24)18(5-8-19-9-6-18)22-10-2-7-21-22/h2,7,10,14-15,19H,3-6,8-9,11-13H2,1H3,(H,20,24) |
| InChIKey | KQMXNQTZSQZPMO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |