C15H19ClN4O2S — CID 120935923
N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide (PubChem CID 120935923) has the molecular formula C15H19ClN4O2S and a molecular weight of 354.86 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120935923 |
| Molecular Formula | C15H19ClN4O2S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
| SMILES | O=C(NCC(O)c1ccc(Cl)s1)C1(n2cccn2)CCNCC1 |
| InChI | InChI=1S/C15H19ClN4O2S/c16-13-3-2-12(23-13)11(21)10-18-14(22)15(4-7-17-8-5-15)20-9-1-6-19-20/h1-3,6,9,11,17,21H,4-5,7-8,10H2,(H,18,22) |
| InChIKey | XGGQOTNEOCPRNG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |