C16H18ClFN4O — CID 120921977
N-[(3-chloro-4-fluorophenyl)methyl]-4-pyrazol-1-ylpiperidine-4-carboxamide (PubChem CID 120921977) has the molecular formula C16H18ClFN4O and a molecular weight of 336.80 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-4-pyrazol-1-ylpiperidine-4-carboxamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120921977 |
| Molecular Formula | C16H18ClFN4O |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)c(Cl)c1)C1(n2cccn2)CCNCC1 |
| InChI | InChI=1S/C16H18ClFN4O/c17-13-10-12(2-3-14(13)18)11-20-15(23)16(4-7-19-8-5-16)22-9-1-6-21-22/h1-3,6,9-10,19H,4-5,7-8,11H2,(H,20,23) |
| InChIKey | IHBYICYSERBNSU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |