C14H17BrN4OS — CID 120925468
N-[(5-bromothiophen-3-yl)methyl]-4-pyrazol-1-ylpiperidine-4-carboxamide (PubChem CID 120925468) has the molecular formula C14H17BrN4OS and a molecular weight of 369.29 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-4-pyrazol-1-ylpiperidine-4-carboxamide.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120925468 |
| Molecular Formula | C14H17BrN4OS |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
| SMILES | O=C(NCc1csc(Br)c1)C1(n2cccn2)CCNCC1 |
| InChI | InChI=1S/C14H17BrN4OS/c15-12-8-11(10-21-12)9-17-13(20)14(2-5-16-6-3-14)19-7-1-4-18-19/h1,4,7-8,10,16H,2-3,5-6,9H2,(H,17,20) |
| InChIKey | NTBDEBWVVACKJR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |