C17H22N6O2 — CID 120920936
N-[[4-(carbamoylamino)phenyl]methyl]-4-pyrazol-1-ylpiperidine-4-carboxamide (PubChem CID 120920936) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[[4-(carbamoylamino)phenyl]methyl]-4-pyrazol-1-ylpiperidine-4-carboxamide.
| Compound Name | N-[[4-(carbamoylamino)phenyl]methyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120920936 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N-[[4-(carbamoylamino)phenyl]methyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
| SMILES | NC(=O)Nc1ccc(CNC(=O)C2(n3cccn3)CCNCC2)cc1 |
| InChI | InChI=1S/C17H22N6O2/c18-16(25)22-14-4-2-13(3-5-14)12-20-15(24)17(6-9-19-10-7-17)23-11-1-8-21-23/h1-5,8,11,19H,6-7,9-10,12H2,(H,20,24)(H3,18,22,25) |
| InChIKey | PACAPDNJFRJLGO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |