C17H21ClN4O2 — CID 120931808
N-[(4-chloro-2-methoxyphenyl)methyl]-4-pyrazol-1-ylpiperidine-4-carboxamide (PubChem CID 120931808) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is N-[(4-chloro-2-methoxyphenyl)methyl]-4-pyrazol-1-ylpiperidine-4-carboxamide.
| Compound Name | N-[(4-chloro-2-methoxyphenyl)methyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120931808 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-[(4-chloro-2-methoxyphenyl)methyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
| SMILES | COc1cc(Cl)ccc1CNC(=O)C1(n2cccn2)CCNCC1 |
| InChI | InChI=1S/C17H21ClN4O2/c1-24-15-11-14(18)4-3-13(15)12-20-16(23)17(5-8-19-9-6-17)22-10-2-7-21-22/h2-4,7,10-11,19H,5-6,8-9,12H2,1H3,(H,20,23) |
| InChIKey | VXQGKWHDSUHDRS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |