C19H26N4O3 — CID 120927526
N-[2-(2,4-dimethoxyphenyl)ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide (PubChem CID 120927526) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[2-(2,4-dimethoxyphenyl)ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide.
| Compound Name | N-[2-(2,4-dimethoxyphenyl)ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120927526 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | N-[2-(2,4-dimethoxyphenyl)ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2(n3cccn3)CCNCC2)c(OC)c1 |
| InChI | InChI=1S/C19H26N4O3/c1-25-16-5-4-15(17(14-16)26-2)6-10-21-18(24)19(7-11-20-12-8-19)23-13-3-9-22-23/h3-5,9,13-14,20H,6-8,10-12H2,1-2H3,(H,21,24) |
| InChIKey | OYHPHBKLPNJZRC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |