C15H25ClN4O2 — CID 120936564
N-methyl-N-(oxolan-3-ylmethyl)-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride (PubChem CID 120936564) has the molecular formula C15H25ClN4O2 and a molecular weight of 328.84 g/mol. Its IUPAC name is N-methyl-N-(oxolan-3-ylmethyl)-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-methyl-N-(oxolan-3-ylmethyl)-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120936564 |
| Molecular Formula | C15H25ClN4O2 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | N-methyl-N-(oxolan-3-ylmethyl)-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride |
| SMILES | CN(CC1CCOC1)C(=O)C1(n2cccn2)CCNCC1.Cl |
| InChI | InChI=1S/C15H24N4O2.ClH/c1-18(11-13-3-10-21-12-13)14(20)15(4-7-16-8-5-15)19-9-2-6-17-19;/h2,6,9,13,16H,3-5,7-8,10-12H2,1H3;1H |
| InChIKey | VVWAQYBKXWPSAI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |