C13H21Cl2N3O2 — CID 120937717
4-(aminomethyl)-N-(6-methyl-2-pyridinyl)oxane-4-carboxamide;dihydrochloride (PubChem CID 120937717) has the molecular formula C13H21Cl2N3O2 and a molecular weight of 322.24 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(6-methyl-2-pyridinyl)oxane-4-carboxamide;dihydrochloride.
| Compound Name | 4-(aminomethyl)-N-(6-methyl-2-pyridinyl)oxane-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120937717 |
| Molecular Formula | C13H21Cl2N3O2 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-(aminomethyl)-N-(6-methyl-2-pyridinyl)oxane-4-carboxamide;dihydrochloride |
| SMILES | Cc1cccc(NC(=O)C2(CN)CCOCC2)n1.Cl.Cl |
| InChI | InChI=1S/C13H19N3O2.2ClH/c1-10-3-2-4-11(15-10)16-12(17)13(9-14)5-7-18-8-6-13;;/h2-4H,5-9,14H2,1H3,(H,15,16,17);2*1H |
| InChIKey | JADPNWGEBSVTDT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |