C22H25Cl2N3O2 — CID 120940738
4-(aminomethyl)-N-(6-naphthalen-2-yl-2-pyridinyl)oxane-4-carboxamide;dihydrochloride (PubChem CID 120940738) has the molecular formula C22H25Cl2N3O2 and a molecular weight of 434.37 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(6-naphthalen-2-yl-2-pyridinyl)oxane-4-carboxamide;dihydrochloride.
| Compound Name | 4-(aminomethyl)-N-(6-naphthalen-2-yl-2-pyridinyl)oxane-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120940738 |
| Molecular Formula | C22H25Cl2N3O2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 4-(aminomethyl)-N-(6-naphthalen-2-yl-2-pyridinyl)oxane-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCC1(C(=O)Nc2cccc(-c3ccc4ccccc4c3)n2)CCOCC1 |
| InChI | InChI=1S/C22H23N3O2.2ClH/c23-15-22(10-12-27-13-11-22)21(26)25-20-7-3-6-19(24-20)18-9-8-16-4-1-2-5-17(16)14-18;;/h1-9,14H,10-13,15,23H2,(H,24,25,26);2*1H |
| InChIKey | UIJJKDAKJLIJLB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |