C19H29Cl2N3O2 — CID 120940199
4-(aminomethyl)-N-[1-(2-methylpropyl)indol-5-yl]oxane-4-carboxamide;dihydrochloride (PubChem CID 120940199) has the molecular formula C19H29Cl2N3O2 and a molecular weight of 402.37 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[1-(2-methylpropyl)indol-5-yl]oxane-4-carboxamide;dihydrochloride.
| Compound Name | 4-(aminomethyl)-N-[1-(2-methylpropyl)indol-5-yl]oxane-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120940199 |
| Molecular Formula | C19H29Cl2N3O2 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 4-(aminomethyl)-N-[1-(2-methylpropyl)indol-5-yl]oxane-4-carboxamide;dihydrochloride |
| SMILES | CC(C)Cn1ccc2cc(NC(=O)C3(CN)CCOCC3)ccc21.Cl.Cl |
| InChI | InChI=1S/C19H27N3O2.2ClH/c1-14(2)12-22-8-5-15-11-16(3-4-17(15)22)21-18(23)19(13-20)6-9-24-10-7-19;;/h3-5,8,11,14H,6-7,9-10,12-13,20H2,1-2H3,(H,21,23);2*1H |
| InChIKey | BSBATCGUPUHDNX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |